CAS 70187-32-5
:4-methylmorpholine-4-oxide monohydrate
Description:
4-Methylmorpholine-4-oxide monohydrate is an organic compound characterized by its morpholine structure, which includes a nitrogen atom in a six-membered ring. This compound is typically a colorless to pale yellow solid that is hygroscopic, meaning it readily absorbs moisture from the environment. It is known for its role as an oxidizing agent and is often utilized in various chemical reactions, particularly in organic synthesis and polymer chemistry. The presence of the methyl group enhances its solubility in polar solvents, making it versatile in different applications. Additionally, the monohydrate form indicates that it contains one molecule of water per molecule of the compound, which can influence its stability and reactivity. Safety considerations should be taken into account, as it may pose health risks upon exposure. Overall, 4-methylmorpholine-4-oxide monohydrate is valued for its chemical properties and utility in laboratory and industrial processes.
Formula:C5H13NO3
InChI:InChI=1/C5H11NO2.H2O/c1-6(7)2-4-8-5-3-6;/h2-5H2,1H3;1H2
SMILES:CN1(=O)CCOCC1.O
Synonyms:- 4-Methylmorpholine N-oxide monohydrate
- 4-Methylmorpholine N-oxide hydrate
- N-methyl morpholine-N-Oxid monohydrate
- 4-MethylmorpholineN-oxide,ca50%aq.soln.
- monohydrate~NMMO
- N-MethylmorpholineN-oxide monohydrate
- 4-Methylmorpholine 4-Oxide
- 4-Methylmorpholine 4-Oxide Hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Methylmorpholine N-oxide monohydrate, 98+%
CAS:4-Methylmorpholine N-oxide monohydrate is used as a solvent to prepare cellulose fibers. It is an oxidant and involved in the catalytic OsO4 oxidation of olefins to cis-1,2-diols. It is also involved in ruthenium catalyzed oxidation of alcohols to aldehydes and ketones. This Thermo Scientific ChemFormula:C5H11NO2Purity:98+%Color and Shape:White to cream, Crystalline powder and/or LumpsMolecular weight:117.154-Methylmorpholine N-oxide monohydrate
CAS:Formula:C5H13NO3Purity:97%Color and Shape:SolidMolecular weight:135.16164-methyl-1,4-oxazinan-4-ium-4-olate hydrate
CAS:4-methyl-1,4-oxazinan-4-ium-4-olate hydratePurity:98%Molecular weight:135.16161g/mol4-Methylmorpholine 4-oxide monohydrate
CAS:Formula:C5H13NO3Purity:95.0%Color and Shape:SolidMolecular weight:135.1634-Methylmorpholine N-oxide monohydrate
CAS:Intermediate for organic synthesesFormula:C5H13NO3Color and Shape:PowderMolecular weight:135.16 g/mol




