CAS 701910-14-7

7-Bromo-2-methyl-2H-indazole

Description:

7-Bromo-2-methyl-2H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 7-position and a methyl group at the 2-position contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other complex molecules. The bromine substituent can enhance reactivity, making it a useful intermediate in organic synthesis. Additionally, the compound may exhibit specific spectral characteristics, such as distinct peaks in NMR and IR spectroscopy, which can be utilized for its identification and characterization. As with many chemical substances, safety precautions should be observed when handling 7-Bromo-2-methyl-2H-indazole, as it may pose health risks or environmental hazards.

Formula: C₈H₇BrN₂

InChI: InChI=1/C8H7BrN2/c1-11-5-6-3-2-4-7(9)8(6)10-11/h2-5H,1H3

SMILES: Cn1cc2cccc(c2n1)Br

7-Bromo-2-methyl-2H-indazole

CAS: 701910-14-7

Formula: C₈H₇BrN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 211.0586

Ref: IN-DA00FAG1

7-Bromo-2-methyl-2H-indazole

CAS: 701910-14-7

7-Bromo-2-methyl-2H-indazole

Formula: C₈H₇BrN₂

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 211.06g/mol

Ref: 54-OR43561

7-Bromo-2-methyl-2H-indazole

CAS: 701910-14-7

Formula: C₈H₇BrN₂

Purity: 98%

Color and Shape: No data available.

Molecular weight: 211.062

Ref: 10-F076802