CAS 70193-21-4
:Trichlamide
Description:
Trichlamide, with the CAS number 70193-21-4, is a chemical compound that belongs to the class of amides. It is characterized by the presence of multiple amide functional groups, which contribute to its chemical reactivity and potential applications. Trichlamide is typically a white to off-white solid, and its solubility can vary depending on the solvent used, often being more soluble in polar solvents. The compound may exhibit specific biological activities, making it of interest in pharmaceutical and agricultural research. Its molecular structure allows for interactions with various biological targets, which can be explored for therapeutic purposes. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with exposure. Overall, trichlamide represents a compound with unique properties that warrant further investigation in both synthetic and applied chemistry contexts.
Formula:C13H16Cl3NO3
InChI:InChI=1S/C13H16Cl3NO3/c1-2-3-8-20-12(13(14,15)16)17-11(19)9-6-4-5-7-10(9)18/h4-7,12,18H,2-3,8H2,1H3,(H,17,19)
InChI key:InChIKey=NHTFLYKPEGXOAN-UHFFFAOYSA-N
SMILES:C(NC(OCCCC)C(Cl)(Cl)Cl)(=O)C1=C(O)C=CC=C1
Synonyms:- Benzamide, N-(1-butoxy-2,2,2-trichloroethyl)-2-hydroxy-
- Hataclean
- N-(1-Butoxy-2,2,2-trichloroethyl)-2-hydroxybenzamide
- N-(1-Butoxy-2,2,2-trichloroethyl)salicylamide
- Nk 483
- Salicylfungi amide
- Wl 105305
- Trichlamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Trichlamide 10 µg/mL in Cyclohexane
CAS:Formula:C13H16Cl3NO3Color and Shape:Single SolutionMolecular weight:340.63N-(1-Butoxy-2,2,2-trichloroethyl)-2-hydroxybenzamide
CAS:Controlled ProductFormula:C13H16Cl3NO3Color and Shape:NeatMolecular weight:340.63

