CAS 70195-21-0
:1,2-Propane-1,1,2-d3-diol
Description:
1,2-Propane-1,1,2-d3-diol, also known as deuterated glycerol, is a deuterated form of glycerol where the hydrogen atoms at specific positions are replaced with deuterium, a stable isotope of hydrogen. This compound is characterized by its viscous, colorless liquid state at room temperature and is soluble in water due to its hydroxyl (-OH) functional groups. The presence of deuterium makes it useful in various applications, particularly in nuclear magnetic resonance (NMR) spectroscopy, where it serves as a solvent or a tracer in metabolic studies. Its molecular structure consists of three carbon atoms, with two hydroxyl groups attached to the first and second carbon, contributing to its hygroscopic nature. The deuteration enhances its stability and alters its physical properties slightly compared to non-deuterated glycerol, making it valuable in research settings. Additionally, it is non-toxic and generally regarded as safe for use in laboratory environments.
Formula:C3H5D3O2
InChI:InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3/i2D2,3D
InChI key:InChIKey=DNIAPMSPPWPWGF-UHVFUKFASA-N
SMILES:C(C(O)([2H])[2H])(C)(O)[2H]
Synonyms:- Glycerol-(hydroxy-d)-3
- 1,2-Propane-1,1,2-d3-diol
- 1,2-Propane-1,1,2-d3-diol, (±)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
