CAS 70198-23-1

L-Lysine, 2-aminoethyl ester, hydrochloride (1:3)

Description:

L-Lysine, 2-aminoethyl ester, hydrochloride (1:3) is a derivative of the amino acid lysine, characterized by the presence of an aminoethyl ester group and a hydrochloride salt form. This compound typically appears as a white crystalline powder and is soluble in water, which enhances its bioavailability for various applications. As a basic amino acid, L-lysine plays a crucial role in protein synthesis and is essential for human health, particularly in growth and tissue repair. The hydrochloride form improves stability and solubility, making it suitable for pharmaceutical formulations. In addition to its nutritional significance, L-lysine derivatives are often explored for their potential therapeutic effects, including antiviral properties and roles in collagen synthesis. The compound's molecular structure includes an amino group, a carboxyl group, and a side chain that contributes to its basicity and reactivity. Overall, L-Lysine, 2-aminoethyl ester, hydrochloride is valued in both dietary supplements and research contexts for its biochemical properties and physiological benefits.

Formula: C₈H₁₉N₃O₂·3ClH

InChI: InChI=1S/C8H19N3O2.3ClH/c9-4-2-1-3-7(11)8(12)13-6-5-10;;;/h7H,1-6,9-11H2;3*1H/t7-;;;/m0.../s1

InChI key: InChIKey=SAKAHFSYUHWBLG-QTPLPEIMSA-N

SMILES: [C@@H](C(OCCN)=O)(CCCCN)N.Cl

Synonyms:

• L-Lysine, hydrochloride (1:3)
• L-Lysine, 2-aminoethyl ester, hydrochloride (1:3)
• L-Lysine, 2-aminoethyl ester, trihydrochloride

L-Lysine, 2-Aminoethyl Ester, Hydrochloride (1:3)

Controlled Product

CAS: 70198-23-1

Formula: C₈H₁₉N₃O₂·3HCl

Color and Shape: Neat

Molecular weight: 298.64

Ref: TR-L812090