CAS 702-69-2

7-methyl-1,4-dioxaspiro[4.5]decan-8-one

Description:

7-Methyl-1,4-dioxaspiro[4.5]decan-8-one, with the CAS number 702-69-2, is a chemical compound characterized by its unique spirocyclic structure, which features a dioxane ring fused to a decanone framework. This compound typically exhibits a molecular formula that reflects its complex structure, incorporating both carbonyl and ether functionalities. The presence of the methyl group at the 7-position contributes to its overall stability and influences its reactivity. As a spiro compound, it possesses distinct stereochemical properties, which can affect its interactions in biological systems and its potential applications in organic synthesis. The compound may exhibit moderate solubility in organic solvents, and its physical properties, such as boiling point and melting point, are influenced by the molecular interactions within its structure. Due to its unique characteristics, 7-methyl-1,4-dioxaspiro[4.5]decan-8-one may be of interest in fields such as medicinal chemistry and materials science, where spiro compounds are often explored for their diverse biological activities and potential as building blocks in synthetic pathways.

Formula: C₉H₁₄O₃

InChI: InChI=1/C9H14O3/c1-7-6-9(3-2-8(7)10)11-4-5-12-9/h7H,2-6H2,1H3

SMILES: CC1CC2(CCC1=O)OCCO2

7-METHYL-1,4-DIOXA-SPIRO[4.5]DECAN-8-ONE

CAS: 702-69-2

Formula: C₉H₁₄O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 170.2057

Ref: IN-DA00FC24

7-Methyl-1,4-dioxaspiro[4.5]decan-8-one

CAS: 702-69-2

7-Methyl-1,4-dioxaspiro[4.5]decan-8-one

Purity: 96%

Molecular weight: 170.21g/mol

Ref: 54-OR471172

7-Methyl-1,4-dioxaspiro[4.5]decan-8-one

CAS: 702-69-2

Formula: C₉H₁₄O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 170.208

Ref: 10-F216761