CAS 702-98-7
:2-Methyl-2-adamantanol
Description:
2-Methyl-2-adamantanol, with the CAS number 702-98-7, is a tertiary alcohol characterized by its unique adamantane structure, which consists of a fused polycyclic framework. This compound features a hydroxyl (-OH) group attached to a carbon atom that is also bonded to a methyl group, contributing to its classification as a tertiary alcohol. It is typically a colorless to pale yellow solid at room temperature and exhibits moderate solubility in water due to the presence of the hydroxyl group, although its hydrophobic adamantane core limits this solubility. The compound is known for its stability and resistance to oxidation, making it useful in various chemical applications. Additionally, 2-methyl-2-adamantanol can serve as a precursor in organic synthesis and may exhibit interesting biological activities, although specific pharmacological properties would require further investigation. Its unique structure and properties make it a subject of interest in both academic and industrial chemistry.
Formula:C11H18O
InChI:InChI=1S/C11H18O/c1-11(12)9-3-7-2-8(5-9)6-10(11)4-7/h7-10,12H,2-6H2,1H3
InChI key:InChIKey=JKOZWMQUOWYZAB-UHFFFAOYSA-N
SMILES:CC1(O)C2CC3CC1CC(C2)C3
Synonyms:- 2-Adamantanol, 2-methyl-
- 2-Hydroxy-2-methyladamantane
- 2-Methyladamantan-2-ol
- 2-Methyltricyclo[3.3.1.1<sup>3,7</sup>]decan-2-ol
- 2-Methyltricyclo[3.3.1.1~3,7~]Decan-2-Ol
- NSC 193482
- Tricyclo(3.3.1.1(3,7))decan-2-ol, 2-methyl-
- Tricyclo[3.3.1.1<sup>3,7</sup>]decan-2-ol, 2-methyl-
- Tricyclo[3.3.1.13,7]decan-2-ol, 2-methyl-
- 2-Methyltricyclo[3.3.1.13,7]decan-2-ol
- 2-Methyl-2-adamantanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Methyl-2-adamantanol
CAS:Formula:C11H18OPurity:>99.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:166.262-Methyl-2-adamantanol
CAS:<p>2-Methyl-2-adamantanol is a chemical compound with the molecular formula CH(CH)COOH. It is a colorless liquid that boils at 109°C and freezes at -78°C. This compound has been used as an additive to gasoline, in cosmetics, as a solvent for polymers, and as a fuel. 2-Methyl-2-adamantanol is synthesized by the reaction of 1-adamantanol with hydrogen chloride gas in the presence of dimethylformamide. The product can be purified by recrystallizing it from methanol or chloroform. The structure of this compound was determined using X-ray crystallography. 2-Methyl-2-adamantanol is an alicyclic molecule that contains two methyl groups (-CH3) on adjacent carbons (C). It also has a hydrogen bond between the two methyl groups on C1 and C2. This compound has been</p>Formula:C11H18OPurity:Min. 95%Color and Shape:PowderMolecular weight:166.1 g/mol
