CAS 70201-54-6

1-[2-(1-methylethoxy)phenyl]ethanone

Description:

1-[2-(1-methylethoxy)phenyl]ethanone, also known by its CAS number 70201-54-6, is an organic compound characterized by its ketone functional group and aromatic structure. This compound features a phenyl ring substituted with an ethoxy group, which contributes to its unique chemical properties. The presence of the ketone group indicates that it can participate in various chemical reactions, such as nucleophilic addition and oxidation. Its molecular structure suggests moderate polarity, which may influence its solubility in organic solvents. Additionally, the compound may exhibit interesting biological activities, making it of interest in fields such as pharmaceuticals and agrochemicals. The stability of the compound under standard conditions is typical for ketones, but specific reactivity can depend on the surrounding environment and functional groups present. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 1-[2-(1-methylethoxy)phenyl]ethanone represents a versatile compound with potential applications in various chemical and industrial processes.

Formula: C₁₁H₁₄O₂

InChI: InChI=1/C11H14O2/c1-8(2)13-11-7-5-4-6-10(11)9(3)12/h4-8H,1-3H3

SMILES: CC(C)Oc1ccccc1C(=O)C

Synonyms:

• 1-(2-Isopropoxyphenyl)ethanone
• Ethanone, 1-[2-(1-Methylethoxy)Phenyl]-

1-(2-isopropoxyphenyl)ethanone

CAS: 70201-54-6

Formula: C₁₁H₁₄O₂

Purity: 95.0%

Molecular weight: 178.231

Ref: 10-F314824