CAS 70203-04-2
:Methyl n-hexylacetoacetate
Description:
Methyl n-hexylacetoacetate, with the CAS number 70203-04-2, is an organic compound that belongs to the class of acetoacetates. It is characterized by its ester functional group, which is formed from the reaction of acetoacetic acid and an alcohol—in this case, methyl alcohol and n-hexyl alcohol. This compound typically appears as a colorless to pale yellow liquid with a fruity or sweet odor, making it potentially useful in flavoring and fragrance applications. Methyl n-hexylacetoacetate is known for its moderate volatility and solubility in organic solvents, while being less soluble in water. It may exhibit properties such as low toxicity, but safety data should be consulted for handling and exposure guidelines. Additionally, it can participate in various chemical reactions, including esterification and hydrolysis, which can be leveraged in synthetic organic chemistry. Overall, its unique structure and properties make it a compound of interest in both industrial and research settings.
Formula:C11H20O3
InChI:InChI=1/C11H20O3/c1-4-5-6-7-8-10(9(2)12)11(13)14-3/h10H,4-8H2,1-3H3
SMILES:CCCCCCC(C(=O)C)C(=O)OC
Synonyms:- Intermediate ofAzidothymidine
- Methyl 2-hexylacetoacetate
- Methyl 2-Acetyloctanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Acetyl-octanoic Acid Methyl Ester
CAS:Controlled ProductApplications A reagent used in the preparation of agrochemicals and antimicrobial agents.
Formula:C11H20O3Color and Shape:NeatMolecular weight:200.28

