CAS 7021-11-6
:4-(4-Hydroxyphenyl)butanoic acid
Description:
4-(4-Hydroxyphenyl)butanoic acid, also known as p-hydroxyphenylbutyric acid, is an organic compound characterized by its aromatic and carboxylic acid functional groups. It features a butanoic acid chain attached to a para-hydroxyphenyl group, which contributes to its chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents like water and alcohols, owing to the presence of the hydroxyl and carboxylic acid groups. It exhibits both acidic and phenolic characteristics, allowing it to participate in various chemical reactions, including esterification and amidation. The compound is of interest in pharmaceutical and biochemical research, particularly for its potential applications in drug development and as a biochemical probe. Its structure allows for interactions with biological systems, making it a subject of study in medicinal chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C10H12O3
InChI:InChI=1S/C10H12O3/c11-9-6-4-8(5-7-9)2-1-3-10(12)13/h4-7,11H,1-3H2,(H,12,13)
InChI key:InChIKey=WTDBNDAYNLGKGW-UHFFFAOYSA-N
SMILES:C(Cc1ccc(cc1)O)CC(=O)O
Synonyms:- 4-Carboxypropylphenol
- 4-Hydroxybenzenebutanoic acid
- Benzenebutanoic Acid, 4-Hydroxy-
- Butyric acid, 4-(p-hydroxyphenyl)-
- NSC 131303
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzenebutanoic acid, 4-hydroxy-
CAS:Formula:C10H12O3Purity:98%Color and Shape:SolidMolecular weight:180.20054-(4-Hydroxyphenyl)butanoic acid
CAS:4-(4-Hydroxyphenyl)butanoic acidPurity:98%Molecular weight:180.20g/mol4-(4-Hydroxyphenyl)butanoic acid
CAS:Formula:C10H12O3Purity:98%Color and Shape:SolidMolecular weight:180.2034-Carboxypropylphenol
CAS:Controlled ProductApplications 4-(4-hydroxyphenyl)butanoic acid (cas# 7021-11-6) is a useful research chemical.
Formula:C10H12O3Color and Shape:NeatMolecular weight:180.24-(4-Hydroxyphenyl)butanoic acid
CAS:4-(4-Hydroxyphenyl)butanoic acid (4HPBA) is a naturally occurring compound that has been shown to inhibit the growth of Gram-positive bacteria. This compound blocks the synthesis of cell walls by binding to the enzyme transglycosylase, inhibiting bacterial cell wall synthesis and leading to bacterial death. 4HPBA also inhibits nerve injury caused by ciprofloxacin in rats by preventing demethylation and copolymerization, which leads to functional groups. This compound may have potential use as a topical treatment for ulcers, wounds, and burns. However, more research is needed to determine its safety and efficacy in humans.Formula:C10H12O3Purity:Min. 95%Molecular weight:180.2 g/mol




