CymitQuimica logo

CAS 7023-27-0

:

monomethyl phosphate di-monocyclohexyl*ammonium C

Description:
Monomethyl phosphate di-monocyclohexylammonium C, with the CAS number 7023-27-0, is an organic compound that features a phosphate group esterified with a monomethyl group and associated with two monocyclohexylammonium cations. This substance typically exhibits characteristics common to phosphates, such as being soluble in polar solvents and having potential applications in various fields, including agriculture and pharmaceuticals. The presence of the monocyclohexylammonium moiety may impart unique properties, such as enhanced solubility and stability in certain environments. Additionally, the compound may exhibit specific reactivity due to the functional groups present, making it useful in chemical synthesis or as a reagent. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance. Overall, monomethyl phosphate di-monocyclohexylammonium C represents a specialized compound with potential utility in various chemical applications.
Formula:C13H31N2O4P
InChI:InChI=1/2C6H13N.CH5O4P/c2*7-6-4-2-1-3-5-6;1-5-6(2,3)4/h2*6H,1-5,7H2;1H3,(H2,2,3,4)
SMILES:C1CCC(CC1)N.C1CCC(CC1)N.COP(=O)(O)O
Synonyms:
  • Methyl Dihydrogen Phosphate - Cyclohexanamine (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.