CAS 7023-38-3

tris(dimethylamino)methylium azide

Description:

Tris(dimethylamino)methylium azide, with the CAS number 7023-38-3, is a chemical compound characterized by its unique structure and properties. It features a central carbon atom bonded to three dimethylamino groups and an azide group, which contributes to its reactivity. The presence of the azide functional group indicates potential for energetic behavior, making it of interest in fields such as materials science and explosives research. The compound is typically a crystalline solid at room temperature and may exhibit sensitivity to heat, shock, or friction, which is common among azide-containing compounds. Its solubility in polar solvents can vary, and it may undergo decomposition under certain conditions, releasing nitrogen gas. Safety precautions are essential when handling this substance due to its potential hazards. Overall, tris(dimethylamino)methylium azide represents a fascinating area of study within the realm of organic and inorganic chemistry, particularly in the context of energetic materials.

Formula: C₇H₂₁N₆

InChI: InChI=1/C7H18N3.N3/c1-8(2)7(9(3)4)10(5)6;1-3-2/h1-6H3;/q+1;-1