CAS 70238-51-6
:(1R,2R,7S,8aR)-1,8a-dimethyl-7-(1-methylethenyl)-6-oxo-1,2,3,4,6,7,8,8a-octahydronaphthalen-2-yl (2Z)-3-(methylsulfanyl)prop-2-enoate
Description:
The chemical substance with the name "(1R,2R,7S,8aR)-1,8a-dimethyl-7-(1-methylethenyl)-6-oxo-1,2,3,4,6,7,8,8a-octahydronaphthalen-2-yl (2Z)-3-(methylsulfanyl)prop-2-enoate" and CAS number 70238-51-6 is a complex organic compound characterized by its multi-ring structure and specific stereochemistry. It features a naphthalene derivative with multiple substituents, including a methylsulfanyl group and a vinyl ester moiety. The presence of stereocenters indicates that the compound can exist in different stereoisomeric forms, which can significantly influence its chemical behavior and biological activity. The compound's structure suggests potential applications in fields such as pharmaceuticals or agrochemicals, where specific stereochemistry can be crucial for efficacy. Additionally, the presence of functional groups like the keto and ester functionalities may contribute to its reactivity and solubility properties. Overall, this compound exemplifies the complexity often found in organic chemistry, particularly in the design of molecules with specific desired properties.
Formula:C19H26O3S
InChI:InChI=1/C19H26O3S/c1-12(2)15-11-19(4)13(3)17(22-18(21)8-9-23-5)7-6-14(19)10-16(15)20/h8-10,13,15,17H,1,6-7,11H2,2-5H3/b9-8-/t13-,15-,17+,19+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
S-Petasin - Petasites japonicus (sweet coltsfoot)
CAS:S-Petasin is a standard botanical extract derived from Petasites japonicus, commonly known as sweet coltsfoot. This product is characterized by its anti-inflammatory properties, primarily sourced from bioactive sesquiterpenes naturally occurring in the plant. The mode of action of S-Petasin involves the inhibition of leukotriene synthesis and the modulation of inflammatory pathways, which can reduce allergic reactions and inflammatory processes.
Formula:C19H26O3SPurity:Min. 95%Color and Shape:PowderMolecular weight:334.47 g/molS-Petasin
CAS:Controlled ProductApplications S-Petasin is a cancer cell proliferation inhibitor.
References Iwayama, M., et al.: Jpn. Kokai Tokkyo Koho, (2018);Formula:C19H26O3SColor and Shape:NeatMolecular weight:334.473

