CAS 70239-82-6
:2-Amino-4-ethynylphenol
Description:
2-Amino-4-ethynylphenol, with the CAS number 70239-82-6, is an organic compound characterized by the presence of an amino group and an ethynyl group attached to a phenolic structure. This compound typically appears as a solid and is known for its potential applications in various fields, including organic synthesis and materials science. The amino group (-NH2) contributes to its basicity and reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The ethynyl group (-C≡CH) introduces a triple bond, which can be involved in further reactions, such as cross-coupling or polymerization. Additionally, the phenolic hydroxyl group (-OH) can engage in hydrogen bonding, influencing the compound's solubility and reactivity. Overall, 2-Amino-4-ethynylphenol is a versatile compound with significant potential in synthetic organic chemistry and the development of functional materials. Safety precautions should be observed when handling this substance, as with many organic chemicals, due to potential toxicity and reactivity.
Formula:C8H7NO
InChI:InChI=1S/C8H7NO/c1-2-6-3-4-8(10)7(9)5-6/h1,3-5,10H,9H2
InChI key:InChIKey=ZKGWICKHFMWNJK-UHFFFAOYSA-N
SMILES:C(#C)C1=CC(N)=C(O)C=C1
Synonyms:- Phenol, 2-amino-4-ethynyl-
- 2-Amino-4-ethynylphenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.