CAS 70241-09-7: Physalin H

Description:Physalin H is a natural compound classified as a physalin, which is a type of steroidal lactone derived from the plant genus Physalis, commonly known for its medicinal properties. It is characterized by its complex molecular structure, which includes a fused steroid framework and various functional groups that contribute to its biological activity. Physalin H has been studied for its potential pharmacological effects, including anti-inflammatory, anticancer, and immunomodulatory properties. Its mechanism of action may involve the modulation of various signaling pathways and the induction of apoptosis in cancer cells. Additionally, Physalin H exhibits low toxicity in certain studies, making it a candidate for further research in drug development. The compound is typically extracted from the aerial parts of Physalis species and may be analyzed using techniques such as chromatography and spectroscopy to confirm its identity and purity. Overall, Physalin H represents a promising area of study in natural product chemistry and pharmacology.

Formula:C₂₈H₃₁ClO₁₀

InChI:InChI=1S/C28H31ClO10/c1-22-10-17-24(3)28-18(22)19(32)27(39-28,36-11-14(22)20(33)37-17)13-9-16(31)25(29)7-4-5-15(30)23(25,2)12(13)6-8-26(28,35)21(34)38-24/h4-5,12-14,16-18,31,35H,6-11H2,1-3H3/t12-,13+,14-,16+,17+,18+,22+,23-,24-,25-,26+,27+,28-/m0/s1

InChI key:InChIKey=YNEPXUIPALKHAU-URURCIEQSA-N

SMILES:O=C1OC2CC3(C)C1COC45OC6(C3C4=O)C(O)(C(=O)OC26C)CCC7C5CC(O)C8(Cl)CC=CC(=O)C78C

Synonyms:
16,24-Cyclo-13,14-secoergost-2-ene-18,26-dioic acid, 5-chloro-14,17:14,27-diepoxy-6,13,20,22-tetrahydroxy-1,15-dioxo-, γ-lactone δ-lactone, (5α,6β,14α,16β,22α,25S)-
(1R,2S,3S,6R,6aS,8aS,10aS,10bS,14aR,15R,16aR,17R,18aR)-14a-Chloro-2,3,6,6a,9,10,10a,14,14a,15,16,16a-dodecahydro-8a,15-dihydroxy-2,6a,10b-trimethyl-17,3-(epoxymethano)-1,17:2,6-dimethano-17H-naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,21(1H,8aH,10bH)-tetrone
Physalin H
17,3-(Epoxymethano)-1,17:2,6-dimethano-17H-naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,21(1H,8aH,10bH)-tetrone, 14a-chloro-2,3,6,6a,9,10,10a,14,14a,15,16,16a-dodecahydro-8a,15-dihydroxy-2,6a,10b-trimethyl-, [1R-(1α,2β,3α,6β,6aα,8aα,10aα,10bβ,14aα,15β,16aβ,17α,18aS*)]-
17,3-(Epoxymethano)-1,17:2,6-dimethano-17H-naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,21(1H,8aH,10bH)-tetrone, 14a-chloro-2,3,6,6a,9,10,10a,14,14a,15,16,16a-dodecahydro-8a,15-dihydroxy-2,6a,10b-trimethyl-, (1R,2S,3S,6R,6aS,8aS,10aS,10bS,14aR,15R,16aR,17R,18aR)-
See more synonyms