CAS 70241-09-7
:Physalin H
Description:
Physalin H is a natural compound classified as a physalin, which is a type of steroidal lactone derived from the plant genus Physalis, commonly known for its medicinal properties. It is characterized by its complex molecular structure, which includes a fused steroid framework and various functional groups that contribute to its biological activity. Physalin H has been studied for its potential pharmacological effects, including anti-inflammatory, anticancer, and immunomodulatory properties. Its mechanism of action may involve the modulation of various signaling pathways and the induction of apoptosis in cancer cells. Additionally, Physalin H exhibits low toxicity in certain studies, making it a candidate for further research in drug development. The compound is typically extracted from the aerial parts of Physalis species and may be analyzed using techniques such as chromatography and spectroscopy to confirm its identity and purity. Overall, Physalin H represents a promising area of study in natural product chemistry and pharmacology.
Formula:C28H31ClO10
InChI:InChI=1S/C28H31ClO10/c1-22-10-17-24(3)28-18(22)19(32)27(39-28,36-11-14(22)20(33)37-17)13-9-16(31)25(29)7-4-5-15(30)23(25,2)12(13)6-8-26(28,35)21(34)38-24/h4-5,12-14,16-18,31,35H,6-11H2,1-3H3/t12-,13+,14-,16+,17+,18+,22+,23-,24-,25-,26+,27+,28-/m0/s1
InChI key:InChIKey=YNEPXUIPALKHAU-URURCIEQSA-N
SMILES:C[C@]12[C@]34[C@]5([C@@]6(C)[C@@](CO[C@](O3)(C5=O)[C@]7([C@](CC[C@@]4(O)C(=O)O1)([C@]8(C)[C@@](Cl)([C@H](O)C7)CC=CC8=O)[H])[H])(C(=O)O[C@@]2(C6)[H])[H])[H]
Synonyms:- 16,24-Cyclo-13,14-secoergost-2-ene-18,26-dioic acid, 5-chloro-14,17:14,27-diepoxy-6,13,20,22-tetrahydroxy-1,15-dioxo-, γ-lactone δ-lactone, (5α,6β,14α,16β,22α,25S)-
- (1R,2S,3S,6R,6aS,8aS,10aS,10bS,14aR,15R,16aR,17R,18aR)-14a-Chloro-2,3,6,6a,9,10,10a,14,14a,15,16,16a-dodecahydro-8a,15-dihydroxy-2,6a,10b-trimethyl-17,3-(epoxymethano)-1,17:2,6-dimethano-17H-naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,21(1H,8aH,10bH)-tetrone
- Physalin H
- 17,3-(Epoxymethano)-1,17:2,6-dimethano-17H-naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,21(1H,8aH,10bH)-tetrone, 14a-chloro-2,3,6,6a,9,10,10a,14,14a,15,16,16a-dodecahydro-8a,15-dihydroxy-2,6a,10b-trimethyl-, [1R-(1α,2β,3α,6β,6aα,8aα,10aα,10bβ,14aα,15β,16aβ,17α,18aS*)]-
- 17,3-(Epoxymethano)-1,17:2,6-dimethano-17H-naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,21(1H,8aH,10bH)-tetrone, 14a-chloro-2,3,6,6a,9,10,10a,14,14a,15,16,16a-dodecahydro-8a,15-dihydroxy-2,6a,10b-trimethyl-, (1R,2S,3S,6R,6aS,8aS,10aS,10bS,14aR,15R,16aR,17R,18aR)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Physalin H
CAS:Physalin H inhibits Hh signal/GLI1-DNA, induces quinone reductase (IR 3.74), suppresses T cells, and is cytotoxic to cancer cells and Leishmania major.Formula:C28H31ClO10Purity:98%Color and Shape:SolidMolecular weight:562.99Physalin H
CAS:Physalin H is a steroidal lactone compound, which is a naturally occurring product isolated from plants of the Physalis genus. This compound is primarily extracted from the calyces or leaves of these plants, known for their traditional medicinal uses. Physalin H exhibits its mode of action through the modulation of various biochemical pathways, such as the inhibition of the NF-kB signaling pathway, which leads to its notable anti-inflammatory and anti-cancer effects.Formula:C28H31ClO10Purity:Min. 95%Molecular weight:563.00 g/mol

