CAS 7025-18-5

5-[(4-Hydroxy-3-methoxyphenyl)methylene]-4-oxo-2-thioxo-3-thiazolidinepropanoic acid

Description:

5-[(4-Hydroxy-3-methoxyphenyl)methylene]-4-oxo-2-thioxo-3-thiazolidinepropanoic acid, with the CAS number 7025-18-5, is a thiazolidine derivative characterized by its unique structural features, including a thiazolidine ring, a methylene bridge, and a phenolic moiety. This compound typically exhibits a range of biological activities, which may include antioxidant and anti-inflammatory properties, making it of interest in pharmaceutical research. The presence of the thioxo group contributes to its reactivity and potential interactions with biological targets. Additionally, the hydroxyl and methoxy substituents on the aromatic ring can influence its solubility and bioavailability. The compound's acidic nature is attributed to the carboxylic acid functional group, which can participate in various chemical reactions, including esterification and salt formation. Overall, this substance represents a class of compounds that may have therapeutic applications, although further studies are necessary to fully elucidate its mechanisms of action and potential uses in medicine.

Formula: C₁₄H₁₃NO₅S₂

InChI: InChI=1S/C14H13NO5S2/c1-20-10-6-8(2-3-9(10)16)7-11-13(19)15(14(21)22-11)5-4-12(17)18/h2-3,6-7,16H,4-5H2,1H3,(H,17,18)

InChI key: InChIKey=QDLPDGYOWIZQAQ-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1C(=O)C(=CC2=CC(OC)=C(O)C=C2)SC1=S

Synonyms:

• 5-[(4-Hydroxy-3-methoxyphenyl)methylene]-4-oxo-2-thioxo-3-thiazolidinepropanoic acid
• 3-Thiazolidinepropanoic acid, 5-[(4-hydroxy-3-methoxyphenyl)methylene]-4-oxo-2-thioxo-
• 3-Thiazolidinepropionic acid, 4-oxo-2-thioxo-5-vanillylidene-

3-(5-(4-hydroxy-3-methoxybenzylidene)-4-oxo-2-thioxothiazolidin-3-yl)propanoic acid

CAS: 7025-18-5

Formula: C₁₄H₁₃NO₅S₂

Purity: 95.0%

Molecular weight: 339.38

Ref: 10-F494480