CAS 70255-49-1

Maysin

Description:

Maysin, with the CAS number 70255-49-1, is a naturally occurring flavonoid compound primarily found in maize (corn) and certain other plants. It is known for its role in plant defense mechanisms, particularly against herbivorous insects. Maysin exhibits antioxidant properties, which contribute to its potential health benefits, including anti-inflammatory and anticancer effects. The compound is characterized by its flavone structure, which includes a chromone backbone with various hydroxyl and methoxy substituents that enhance its biological activity. Maysin's solubility is generally higher in organic solvents than in water, which influences its extraction and application in food and pharmaceutical industries. Additionally, research into maysin has highlighted its potential as a natural pesticide and its role in enhancing the nutritional profile of maize-based products. Overall, maysin represents a significant area of interest in both agricultural and medicinal chemistry due to its diverse biological activities and potential applications.

Formula: C₂₇H₂₈O₁₄

InChI: InChI=1S/C27H28O14/c1-8-20(33)23(36)26(41-27-24(37)22(35)19(32)9(2)39-27)25(38-8)18-14(31)7-16-17(21(18)34)13(30)6-15(40-16)10-3-4-11(28)12(29)5-10/h3-9,19,22-29,31-32,34-37H,1-2H3

InChI key: InChIKey=GKLSYIMLZDYQBJ-UHFFFAOYSA-N

SMILES: O(C1C(OC(C)C(=O)C1O)C=2C(O)=C3C(=CC2O)OC(=CC3=O)C4=CC(O)=C(O)C=C4)C5C(O)C(O)C(O)C(C)O5

Synonyms:

• xylo-3-Hexulose, 2,6-anhydro-1-deoxy-5-O-(6-deoxy-α-L-mannopyranosyl)-6-C-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-1-benzopyran-6-yl]-
• Maysin
• 2,6-Anhydro-1-deoxy-5-O-(6-deoxy-α-L-mannopyranosyl)-6-C-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-1-benzopyran-6-yl]-xylo-3-hexulose

Maysin

CAS: 70255-49-1

Maysin, from corn silk, protects neurons from Syn amyloid damage and oxidative stress, aiding PD research.

Formula: C₂₇H₂₈O₁₄

Color and Shape: Solid

Molecular weight: 576.5

Ref: TM-T73912