CAS 70260-18-3

2-(Chloromethyl)-3-iodothiophene

Description:

2-(Chloromethyl)-3-iodothiophene is an organosulfur compound characterized by the presence of both chlorine and iodine substituents on a thiophene ring. The thiophene structure consists of a five-membered aromatic ring containing four carbon atoms and one sulfur atom, which contributes to its unique electronic properties. The chloromethyl group (-CH2Cl) is attached to the second carbon of the thiophene ring, while the iodine atom is located at the third position. This compound is typically used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of halogen atoms, which can participate in nucleophilic substitution reactions. Additionally, the compound's physical properties, such as solubility and melting point, can vary based on the specific conditions and solvents used. Safety precautions should be taken when handling this compound, as both chlorine and iodine are hazardous substances.

Formula: C₅H₄ClIS

InChI: InChI=1S/C5H4ClIS/c6-3-5-4(7)1-2-8-5/h1-2H,3H2

InChI key: InChIKey=OFGMUSRWYUFAKS-UHFFFAOYSA-N

SMILES: C(Cl)C1=C(I)C=CS1

Synonyms:

• 2-(Chloromethyl)-3-iodothiophene
• Thiophene, 2-(chloromethyl)-3-iodo-