CAS 702641-04-1

2-iodo-5-(trifluoromethyl)benzoic acid

Description:

2-Iodo-5-(trifluoromethyl)benzoic acid is an aromatic carboxylic acid characterized by the presence of an iodine atom and a trifluoromethyl group attached to a benzene ring. The molecular structure features a benzoic acid moiety, which includes a carboxylic acid functional group (-COOH) that contributes to its acidic properties. The iodine substituent at the second position and the trifluoromethyl group at the fifth position significantly influence the compound's reactivity and polarity. This compound is typically used in organic synthesis and medicinal chemistry, often serving as an intermediate in the preparation of various pharmaceuticals and agrochemicals. Its unique electronic properties, imparted by the electronegative trifluoromethyl group, can enhance the compound's biological activity. Additionally, the presence of halogens like iodine can affect the compound's solubility and stability. Safety precautions should be observed when handling this substance, as it may pose health risks due to its halogenated nature.

Formula: C₈H₄F₃IO₂

InChI: InChI=1/C8H4F3IO2/c9-8(10,11)4-1-2-6(12)5(3-4)7(13)14/h1-3H,(H,13,14)

SMILES: c1cc(c(cc1C(F)(F)F)C(=O)O)I

Synonyms:

• Benzoic Acid, 2-Iodo-5-(Trifluoromethyl)-

2-Iodo-5-(trifluoromethyl)benzoic acid

CAS: 702641-04-1

Formula: C₈H₄F₃IO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 316.0158

Ref: IN-DA005KFI

2-Iodo-5-(trifluoromethyl)benzoic acid

CAS: 702641-04-1

2-Iodo-5-(trifluoromethyl)benzoic acid

Formula: C₈H₄F₃IO₂

Purity: 97%

Color and Shape: white to off white solid

Molecular weight: 316.02g/mol

Ref: 54-PC48309

2-Iodo-5-(trifluoromethyl)benzoic acid

CAS: 702641-04-1

Formula: C₈H₄F₃IO₂

Purity: 95%

Color and Shape: No data available.

Molecular weight: 316.018

Ref: 10-F065760