CAS 70265-60-0
:2-{2-[2-(2-methoxyphenoxy)ethoxy]ethoxy}-N-phenylacetamide
Description:
2-{2-[2-(2-methoxyphenoxy)ethoxy]ethoxy}-N-phenylacetamide, with the CAS number 70265-60-0, is a synthetic organic compound characterized by its complex structure, which includes multiple ether linkages and an acetamide functional group. This compound features a phenyl group attached to an acetamide, contributing to its potential biological activity. The presence of the methoxyphenoxy moiety suggests that it may exhibit interesting solubility properties and could interact with various biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including anti-inflammatory or analgesic effects. The molecular structure indicates that it may have moderate to high lipophilicity, which can influence its absorption and distribution in biological systems. Additionally, the presence of multiple ether groups may enhance its stability and solubility in organic solvents. Overall, this compound's unique structural features make it a candidate for further research in medicinal chemistry and drug development.
Formula:C19H23NO5
InChI:InChI=1/C19H23NO5/c1-22-17-9-5-6-10-18(17)25-14-13-23-11-12-24-15-19(21)20-16-7-3-2-4-8-16/h2-10H,11-15H2,1H3,(H,20,21)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(2-(2-(2-Methoxyphenoxy)ethoxy)ethoxy)-N-phenylacetamide
CAS:Formula:C19H23NO5Molecular weight:345.38962

