CymitQuimica logo

CAS 702670-05-1

:

1-[(3-Chlorophenyl)methyl]-1H-pyrrole-2-carboxylic acid

Description:
1-[(3-Chlorophenyl)methyl]-1H-pyrrole-2-carboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrrole ring substituted with a carboxylic acid group and a 3-chlorobenzyl moiety. The presence of the chlorophenyl group contributes to its potential biological activity, as halogenated aromatic compounds often exhibit interesting pharmacological properties. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its aromatic and polar functional groups. The carboxylic acid group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the compound may exhibit acidic properties, allowing it to act as a proton donor in various chemical reactions. Its specific applications and behavior in biological systems would depend on further studies, including its mechanism of action, toxicity, and potential therapeutic uses. Overall, this compound represents a class of organic molecules that may have significance in medicinal chemistry and drug development.
Formula:C12H10ClNO2
InChI:InChI=1S/C12H10ClNO2/c13-10-4-1-3-9(7-10)8-14-6-2-5-11(14)12(15)16/h1-7H,8H2,(H,15,16)
InChI key:InChIKey=VPTUTBZAHHDMAA-UHFFFAOYSA-N
SMILES:C(N1C(C(O)=O)=CC=C1)C2=CC(Cl)=CC=C2
Synonyms:
  • 1-[(3-Chlorophenyl)methyl]-1H-pyrrole-2-carboxylic acid
  • 1H-Pyrrole-2-carboxylic acid, 1-[(3-chlorophenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.