CAS 70277-02-0
:3-Iodo-L-tyrosine methyl ester
Description:
3-Iodo-L-tyrosine methyl ester is a chemical compound that belongs to the class of amino acid derivatives, specifically a modified form of the amino acid tyrosine. It features an iodine atom substituted at the 3-position of the aromatic ring, which can influence its biological activity and reactivity. The methyl ester functional group enhances its solubility and stability, making it useful in various biochemical applications. This compound is often utilized in research settings, particularly in studies related to thyroid hormone synthesis and metabolism, as well as in the development of pharmaceuticals. Its molecular structure includes a phenolic hydroxyl group, which can participate in hydrogen bonding and contribute to its interactions in biological systems. Additionally, the presence of the iodine atom may impart unique properties, such as increased lipophilicity or altered binding affinities to certain receptors. Overall, 3-Iodo-L-tyrosine methyl ester serves as a valuable tool in both synthetic and medicinal chemistry.
Formula:C10H12INO3
InChI:InChI=1/C10H12INO3/c1-15-10(14)8(12)5-6-2-3-9(13)7(11)4-6/h2-4,8,13H,5,12H2,1H3/t8-/m0/s1
SMILES:COC(=O)[C@H](Cc1ccc(c(c1)I)O)N
Synonyms:- L-Tyrosine, 3-Iodo-, Methyl Ester
- 3-Indo-L-Tyrosine Methyl Ester
- 3-Iodo-L-Tyrosine Methyl Ester,98%Min
- methyl 3-iodo-L-tyrosinate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
