
CAS 70287-30-8
:rel-(6R,7R)-7-Amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Description:
Rel-(6R,7R)-7-Amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, with CAS number 70287-30-8, is a bicyclic compound characterized by its unique structural features, including a thiazolidine ring and an amino group. This compound is part of a class of antibiotics known as thienamycin derivatives, which exhibit potent antibacterial activity. Its structure includes a carboxylic acid functional group, contributing to its solubility and reactivity. The presence of the amino group enhances its interaction with bacterial ribosomes, inhibiting protein synthesis. The stereochemistry indicated by the (6R,7R) configuration suggests specific spatial arrangements that are crucial for its biological activity. This compound is typically studied for its potential therapeutic applications, particularly in treating infections caused by resistant bacterial strains. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it an interesting subject for further research in medicinal chemistry and pharmacology.
Formula:C8H10N2O3S
InChI:InChI=1/C8H10N2O3S/c1-3-2-14-7-4(9)6(11)10(7)5(3)8(12)13/h4,7H,2,9H2,1H3,(H,12,13)/t4-,7-/s2
InChI key:InChIKey=NVIAYEIXYQCDAN-LJJHQABBNA-N
SMILES:C(O)(=O)C=1N2[C@@]([C@H](N)C2=O)(SCC1C)[H]
Synonyms:- 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-amino-3-methyl-8-oxo-, (6R,7R)-rel-
- 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-amino-3-methyl-8-oxo-, trans-
- 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-amino-3-methyl-8-oxo-, trans-(±)-
- rel-(6R,7R)-7-Amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
rel-(6R,7R)-7-Amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
CAS:Formula:C8H10N2O3SMolecular weight:214.2416
