CAS 70289-35-9

N-(benzyloxy)-1-(6-methylpyridin-2-yl)methanimine

Description:

N-(benzyloxy)-1-(6-methylpyridin-2-yl)methanimine, with the CAS number 70289-35-9, is an organic compound characterized by its unique structural features. It contains a benzyloxy group, which contributes to its aromatic properties, and a pyridine ring that imparts basicity and potential reactivity due to the nitrogen atom in the ring. The presence of the methanimine functional group indicates that it has a double bond between carbon and nitrogen, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. This compound may exhibit moderate solubility in organic solvents, influenced by its hydrophobic benzyloxy and pyridine components. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridine moiety, which is often found in biologically active compounds. Additionally, the compound's reactivity and stability can be affected by environmental factors such as pH and temperature, making it a subject of interest for further research in synthetic organic chemistry.

Formula: C₁₄H₁₄N₂O

InChI: InChI=1/C14H14N2O/c1-12-6-5-9-14(16-12)10-15-17-11-13-7-3-2-4-8-13/h2-10H,11H2,1H3

SMILES: Cc1cccc(C=NOCc2ccccc2)n1