CAS 70290-39-0

5-Amino-2-(methylthio)benzoic acid

Description:

5-Amino-2-(methylthio)benzoic acid, with the CAS number 70290-39-0, is an organic compound characterized by the presence of an amino group and a methylthio group attached to a benzoic acid structure. This compound typically appears as a solid and is soluble in polar solvents, reflecting its acidic nature due to the carboxylic acid functional group. The amino group contributes to its basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The methylthio group enhances its reactivity and can influence its biological activity, making it of interest in pharmaceutical and biochemical research. Additionally, this compound may exhibit specific optical properties and can be analyzed using techniques such as NMR and mass spectrometry. Its unique structure allows for potential applications in drug development, particularly in the synthesis of biologically active molecules. Overall, 5-Amino-2-(methylthio)benzoic acid is a versatile compound with significant implications in organic chemistry and medicinal chemistry.

Formula: C₈H₉NO₂S

InChI: InChI=1S/C8H9NO2S/c1-12-7-3-2-5(9)4-6(7)8(10)11/h2-4H,9H2,1H3,(H,10,11)

InChI key: InChIKey=SMVYKRHYDNFARE-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(SC)C=CC(N)=C1

Synonyms:

• Benzoic acid, 5-amino-2-(methylthio)-
• 5-Amino-2-(methylthio)benzoic acid