CAS 70291-28-0

2-Chloro-5-(5-methyl-1,3,4-oxadiazol-2-yl)pyridine

Description:

2-Chloro-5-(5-methyl-1,3,4-oxadiazol-2-yl)pyridine is a heterocyclic compound characterized by the presence of both a pyridine ring and an oxadiazole moiety. The pyridine ring contributes to its aromatic properties, while the oxadiazole provides unique reactivity due to the presence of nitrogen and oxygen atoms. This compound typically exhibits moderate to high polarity, which can influence its solubility in various solvents. The chlorine substituent at the 2-position of the pyridine ring can enhance its reactivity, making it a potential candidate for further chemical modifications or applications in medicinal chemistry. The presence of the 5-methyl-1,3,4-oxadiazol-2-yl group may impart biological activity, as oxadiazoles are often associated with pharmacological properties. Overall, this compound's structural features suggest potential utility in drug development, agrochemicals, or as a building block in organic synthesis. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require empirical measurement or detailed literature references for precise values.

Formula: C₈H₆ClN₃O

InChI: InChI=1S/C8H6ClN3O/c1-5-11-12-8(13-5)6-2-3-7(9)10-4-6/h2-4H,1H3

InChI key: InChIKey=SQFYYVFBLZUVBR-UHFFFAOYSA-N

SMILES: CC=1OC(C=2C=CC(Cl)=NC2)=NN1

Synonyms:

• Pyridine, 2-chloro-5-(5-methyl-1,3,4-oxadiazol-2-yl)-
• 2-Chloro-5-(5-methyl-1,3,4-oxadiazol-2-yl)pyridine
• 2-Chloro-5-(5-methyl-[1,3,4]oxadiazol-2-yl)pyridine