CAS 70291-62-2

2-amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile

Description:

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a thiophene and a cyclopentane moiety. The presence of an amino group and a cyano group contributes to its reactivity and potential applications in medicinal chemistry and organic synthesis. This compound typically exhibits moderate solubility in polar organic solvents, which can facilitate its use in various chemical reactions. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug discovery. The compound's properties, such as melting point, boiling point, and spectral characteristics (like NMR and IR), are influenced by its functional groups and ring structure. Additionally, the presence of the thiophene ring may impart certain electronic properties, enhancing its utility in electronic materials or as a building block in the synthesis of more complex molecules. Overall, 2-amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile represents a versatile compound in the field of organic chemistry.

Formula: C₈H₈N₂S

InChI: InChI=1/C8H8N2S/c9-4-6-5-2-1-3-7(5)11-8(6)10/h1-3,10H2

SMILES: C1Cc2c(C#N)c(N)sc2C1

Synonyms:

• 4H-Cyclopenta[b]thiophene-3-carbonitrile, 2-amino-5,6-dihydro-

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile

CAS: 70291-62-2

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₈H₈N₂S

Color and Shape: Crystals or powder or crystalline powder, Pale brown

Molecular weight: 164.23

Ref: 02-H32059

2-Amino-4,5-trimethylene-3-thiophenecarbonitrile

CAS: 70291-62-2

2-Amino-4,5-trimethylene-3-thiophenecarbonitrile

Purity: ≥95%

Molecular weight: 164.23g/mol

Ref: 54-OR7033

2-Amino-5,6-dihydro-4 H -cyclopenta[ b ]thiophene-3-carbonitrile

CAS: 70291-62-2

Formula: C₈H₈N₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 164.23

Ref: 10-F030605