CAS 70298-88-3
:2,2-dimethyl-N-pyridin-3-ylpropanamide
Description:
2,2-Dimethyl-N-pyridin-3-ylpropanamide is an organic compound characterized by its amide functional group, which is derived from the reaction of a carboxylic acid and an amine. This compound features a pyridine ring, which contributes to its aromatic properties and potential biological activity. The presence of two methyl groups at the 2-position of the propanamide backbone enhances its steric properties and may influence its solubility and reactivity. The pyridine moiety can participate in hydrogen bonding and may interact with various biological targets, making this compound of interest in medicinal chemistry. Its molecular structure suggests it may exhibit lipophilic characteristics, which can affect its pharmacokinetics. Additionally, the compound's CAS number, 70298-88-3, allows for easy identification in chemical databases. Overall, 2,2-dimethyl-N-pyridin-3-ylpropanamide is a compound with potential applications in drug development and research, particularly in areas related to its structural and functional properties.
Formula:C10H14N2O
InChI:InChI=1/C10H14N2O/c1-10(2,3)9(13)12-8-5-4-6-11-7-8/h4-7H,1-3H3,(H,12,13)
SMILES:CC(C)(C)C(=Nc1cccnc1)O
Synonyms:- 2,2-Dimethyl-N-(pyridin-3-yl)propanamide
- propanamide, 2,2-dimethyl-N-3-pyridinyl-
- 2,2-Dimethyl-N-Pyridin-3-Yl-Propionamide
- 2,2-Dimethyl-N-pyridine-3yl-propionamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-(3-Pyridyl)pivalamide
CAS:Formula:C10H14N2OPurity:>98.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:178.242,2-Dimehtyl-N-pyridin-3-yl-propionamide
CAS:Formula:C10H14N2OPurity:98%Color and Shape:SolidMolecular weight:178.23102,2-Dimehtyl-N-pyridin-3-yl-propionamide
CAS:Formula:C10H14N2OPurity:98%Color and Shape:SolidMolecular weight:178.2352,2-Dimethyl-N-pyridin-3-yl-propionamide
CAS:2,2-Dimethyl-N-pyridin-3-yl-propionamide is a tertiary amide with a pyridine ring that forms a dimer. It is soluble in water and has no odor or taste. 2,2-Dimethyl-N-pyridin-3-yl-propionamide has two orientations and hydrogen bonds occur between the tertiary amide groups. There are also two carbonyls in this compound, which are C=O groups. The crystal structure of 2,2-Dimethyl-N-pyridin3ylpropionamide is disordered because it does not have any long range order.Formula:C10H14N2OPurity:Min. 95%Molecular weight:178.23 g/mol




