CAS 70298-90-7

2,2-Dimethyl-N-(5-nitro-2-pyridinyl)propanamide

Description:

2,2-Dimethyl-N-(5-nitro-2-pyridinyl)propanamide, with the CAS number 70298-90-7, is a chemical compound characterized by its amide functional group and a pyridine ring substituted with a nitro group. This compound features a branched alkyl chain, specifically a 2,2-dimethyl group, which contributes to its steric properties. The presence of the nitro group on the pyridine ring enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate solubility in organic solvents due to its polar amide group and non-polar hydrocarbon portions. Its molecular structure suggests potential applications in pharmaceuticals, particularly as a building block for drug synthesis or as a lead compound in drug discovery. Additionally, the presence of both electron-withdrawing (nitro) and electron-donating (alkyl) groups may affect its electronic properties, influencing interactions with biological targets. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity associated with nitro compounds.

Formula: C₁₀H₁₃N₃O₃

InChI: InChI=1S/C10H13N3O3/c1-10(2,3)9(14)12-8-5-4-7(6-11-8)13(15)16/h4-6H,1-3H3,(H,11,12,14)

InChI key: InChIKey=KCXYNFXBUIMCGC-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)C)=O)C1=CC=C(N(=O)=O)C=N1

Synonyms:

• 2,2-Dimethyl-N-(5-nitro-2-pyridinyl)propanamide
• 2,2-Dimethyl-N-(5-nitropyridin-2-yl)propanamide
• Propanamide, 2,2-dimethyl-N-(5-nitro-2-pyridinyl)-