CymitQuimica logo

CAS 703-67-3

:

6-Fluoro-1-tetralone

Description:
6-Fluoro-1-tetralone, with the CAS number 703-67-3, is an organic compound characterized by its bicyclic structure, which consists of a fused cyclohexane and cyclopentane ring system. The presence of a fluorine atom at the 6-position of the tetralone structure introduces unique electronic and steric properties, influencing its reactivity and potential applications. This compound typically exhibits a ketone functional group, which contributes to its chemical reactivity, particularly in nucleophilic addition reactions. 6-Fluoro-1-tetralone is often utilized in synthetic organic chemistry as an intermediate in the production of various pharmaceuticals and agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the compound. Additionally, the fluorine substituent can enhance lipophilicity, potentially affecting the compound's biological activity and interaction with biological systems. Overall, 6-Fluoro-1-tetralone serves as a valuable building block in the development of more complex chemical entities.
Formula:C10H9FO
InChI:InChI=1/C10H9FO/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h4-6H,1-3H2
InChI key:NJYZZEHPEKDFEK-UHFFFAOYSA-N
SMILES:C1Cc2cc(ccc2C(=O)C1)F
Synonyms:
  • 6-Fluoro-3,4-dihydro-2H-naphthalen-1-one
  • 6-fluoro-3,4-dihydronaphthalen-1(2H)-one
Found 4 products.