CAS 70301-50-7

2-{[(furan-2-ylmethyl)amino]methyl}phenol

Description:

2-{[(Furan-2-ylmethyl)amino]methyl}phenol, with the CAS number 70301-50-7, is an organic compound characterized by its unique structure that includes both a furan ring and a phenolic group. This compound features an amino group that connects a furan-2-ylmethyl moiety to a phenol, which contributes to its potential biological activity. The presence of the furan ring suggests that it may exhibit interesting electronic properties and reactivity, while the phenolic hydroxyl group can participate in hydrogen bonding and may influence solubility and reactivity in various environments. The compound is likely to be soluble in organic solvents and may have applications in pharmaceuticals or as a chemical intermediate due to its functional groups. Additionally, the structural features may impart antioxidant properties, making it of interest in medicinal chemistry. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications.

Formula: C₁₂H₁₃NO₂

InChI: InChI=1/C12H13NO2/c14-12-6-2-1-4-10(12)8-13-9-11-5-3-7-15-11/h1-7,13-14H,8-9H2

SMILES: c1ccc(c(c1)CNCc1ccco1)O

2-{[(Furan-2-ylmethyl)amino]methyl}phenol

CAS: 70301-50-7

Versatile small molecule scaffold

Formula: C₁₂H₁₃NO₂

Purity: Min. 95%

Molecular weight: 203.24 g/mol

Ref: 3D-VCA30150