
CAS 70312-01-5
:6-Amino-5,6,7,8-tetrahydro-2-naphthalenol
Description:
6-Amino-5,6,7,8-tetrahydro-2-naphthalenol, with the CAS number 70312-01-5, is an organic compound characterized by its bicyclic structure, which includes a naphthalene moiety. This compound features an amino group (-NH2) and a hydroxyl group (-OH) attached to the naphthalene ring, contributing to its potential as a biologically active molecule. The presence of the tetrahydro configuration indicates that the compound has undergone partial hydrogenation, resulting in a saturated ring system that can influence its reactivity and solubility. Typically, such compounds may exhibit properties such as moderate polarity, which can affect their interactions in biological systems. The amino and hydroxyl groups can participate in hydrogen bonding, enhancing solubility in polar solvents. This compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could lead to various biological activities. However, specific applications and biological effects would require further investigation through empirical studies.
Formula:C10H13NO
InChI:InChI=1S/C10H13NO/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h2,4,6,9,12H,1,3,5,11H2
InChI key:InChIKey=QXGFZXONNHGLNR-UHFFFAOYSA-N
SMILES:NC1CC=2C(=CC(O)=CC2)CC1
Synonyms:- 2-Naphthalenol, 6-amino-5,6,7,8-tetrahydro-
- 6-Amino-5,6,7,8-tetrahydro-2-naphthalenol
- 2-Aminotetralin-6-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.