CAS 70331-81-6
:2-hydroxy-3-iodo-5-nitrobenzaldehyde
Description:
2-Hydroxy-3-iodo-5-nitrobenzaldehyde, with the CAS number 70331-81-6, is an organic compound characterized by the presence of a benzaldehyde functional group, a hydroxyl group (-OH), an iodine atom, and a nitro group (-NO2) on a benzene ring. This compound typically exhibits a yellow to brown color and is soluble in organic solvents. The presence of the hydroxyl group contributes to its potential as a phenolic compound, while the nitro group enhances its reactivity, making it useful in various chemical syntheses. The iodine substituent can influence the compound's electronic properties and reactivity, potentially making it a candidate for further functionalization or as an intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its unique combination of functional groups suggests potential applications in dye chemistry, pharmaceuticals, or as a reagent in organic reactions. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H4INO4
InChI:InChI=1/C7H4INO4/c8-6-2-5(9(12)13)1-4(3-10)7(6)11/h1-3,11H
SMILES:c1c(C=O)c(c(cc1N(=O)=O)I)O
Synonyms:- Benzaldehyde, 2-Hydroxy-3-Iodo-5-Nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.