CAS 70334-60-0
:1-(3-Azidophenyl)ethanone
Description:
1-(3-Azidophenyl)ethanone, with the CAS number 70334-60-0, is an organic compound characterized by the presence of an azide functional group (-N3) attached to a phenyl ring, which is further connected to an ethanone (ketone) moiety. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. The azide group is known for its reactivity, particularly in click chemistry and as a precursor for various nitrogen-containing compounds. The presence of the ketone group contributes to its potential reactivity in nucleophilic addition reactions. 1-(3-Azidophenyl)ethanone may exhibit properties such as moderate solubility in organic solvents and stability under standard laboratory conditions, although it should be handled with care due to the potential hazards associated with azides, including their explosive nature under certain conditions. Its applications may span across organic synthesis, materials science, and medicinal chemistry, particularly in the development of new pharmaceuticals or functional materials.
Formula:C8H7N3O
InChI:InChI=1S/C8H7N3O/c1-6(12)7-3-2-4-8(5-7)10-11-9/h2-5H,1H3
InChI key:InChIKey=HANPLRJJHYSJSF-UHFFFAOYSA-N
SMILES:N(=[N+]=[N-])C1=CC(C(C)=O)=CC=C1
Synonyms:- 3-Acetylphenyl azide
- 3-Azidoacetophenone
- Ethanone, 1-(3-azidophenyl)-
- m-Azidoacetophenone
- 1-(3-Azidophenyl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-(3-Azidophenyl)ethan-1-one
CAS:Controlled ProductFormula:C8H7N3OColor and Shape:NeatMolecular weight:161.161
