CAS 70335-57-8

1,4-Dihydro-6-methoxy-2-naphthalenecarboxylic acid

Description:

1,4-Dihydro-6-methoxy-2-naphthalenecarboxylic acid, with the CAS number 70335-57-8, is a chemical compound characterized by its naphthalene structure, which features a methoxy group and a carboxylic acid functional group. This compound typically exhibits properties associated with naphthalene derivatives, such as moderate solubility in organic solvents and limited solubility in water. The presence of the methoxy group can influence its reactivity and polarity, making it a potential candidate for various chemical reactions, including esterification and substitution reactions. Additionally, the carboxylic acid group contributes to its acidity and potential for forming salts or esters. The compound may also exhibit biological activity, which could be of interest in pharmaceutical research. Its structural features suggest potential applications in organic synthesis, materials science, or as an intermediate in the production of more complex molecules. As with many organic compounds, safety data should be consulted to understand its handling and toxicity.

Formula: C₁₂H₁₂O₃

InChI: InChI=1S/C12H12O3/c1-15-11-5-4-8-6-10(12(13)14)3-2-9(8)7-11/h3-5,7H,2,6H2,1H3,(H,13,14)

InChI key: InChIKey=MSHBWRSHOIMMSG-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1CC=2C(=CC(OC)=CC2)CC1

Synonyms:

• 1,4-Dihydro-6-methoxy-2-naphthalenecarboxylic acid
• 2-Naphthalenecarboxylic acid, 1,4-dihydro-6-methoxy-

6-methoxy-1,4-dihydronaphthalene-2-carboxylic acid

CAS: 70335-57-8

Formula: C₁₂H₁₂O₃

Purity: 95.0%

Molecular weight: 204.225

Ref: 10-F496009