CAS 70339-08-1
:N-(1-Methylethyl)-4-nitro-2-(trifluoromethyl)benzenamine
Description:
N-(1-Methylethyl)-4-nitro-2-(trifluoromethyl)benzenamine, with the CAS number 70339-08-1, is an organic compound characterized by its aromatic structure, which includes a nitro group and a trifluoromethyl group attached to a benzene ring. The presence of the nitro group (-NO2) indicates that it is a strong electron-withdrawing substituent, which can influence the compound's reactivity and stability. The trifluoromethyl group (-CF3) is also a significant feature, known for imparting unique electronic properties and enhancing lipophilicity. The isopropylamine moiety (N-(1-Methylethyl)) contributes to the compound's basicity and potential for forming hydrogen bonds. This compound may exhibit various chemical behaviors, including potential applications in pharmaceuticals or agrochemicals, owing to its functional groups. Additionally, its physical properties, such as solubility and melting point, would be influenced by the overall molecular structure and the presence of these substituents. Safety and handling considerations should be taken into account due to the presence of the nitro group, which can pose hazards in certain conditions.
Formula:C10H11F3N2O2
InChI:InChI=1S/C10H11F3N2O2/c1-6(2)14-9-4-3-7(15(16)17)5-8(9)10(11,12)13/h3-6,14H,1-2H3
InChI key:InChIKey=MDYMVCKIVPOBCK-UHFFFAOYSA-N
SMILES:N(C(C)C)C1=C(C(F)(F)F)C=C(N(=O)=O)C=C1
Synonyms:- Benzenamine, N-(1-methylethyl)-4-nitro-2-(trifluoromethyl)-
- N-(1-Methylethyl)-4-nitro-2-(trifluoromethyl)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.