CAS 70343-06-5
:3-Methyl-2,6-dinitroaniline
Description:
3-Methyl-2,6-dinitroaniline is an organic compound characterized by its aniline structure, which includes an amino group (-NH2) attached to a benzene ring that is further substituted with two nitro groups (-NO2) and a methyl group (-CH3). This compound is typically a yellow to orange solid and is known for its potential use in various chemical applications, including as an intermediate in the synthesis of dyes and pharmaceuticals. It exhibits properties typical of nitroanilines, such as being a strong electron-withdrawing agent due to the presence of the nitro groups, which can influence its reactivity and stability. The compound is also likely to be sensitive to heat and may pose environmental and health risks, necessitating careful handling and storage. As with many nitro compounds, it may be hazardous and should be managed in accordance with safety regulations. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be referenced from reliable chemical databases or literature for precise applications.
Formula:C7H7N3O4
InChI:InChI=1S/C7H7N3O4/c1-4-2-3-5(9(11)12)6(8)7(4)10(13)14/h2-3H,8H2,1H3
InChI key:InChIKey=KZSINJBSWZJVRO-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N)C(N(=O)=O)=CC=C1C
Synonyms:- 1-Amino-2,6-dinitro-3-methylbenzene
- 3-Amino-2,4-dinitrotoluene
- 3-Methyl-2,6-dinitrobenzenamine
- 5-Methyl-2,6-dinitroaniline
- Benzenamine, 3-Methyl-2,6-Dinitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.