CymitQuimica logo

CAS 70343-13-4

:

1H-Indole-2,3-dione, 7-methyl-5-nitro-

Description:
1H-Indole-2,3-dione, 7-methyl-5-nitro- is a chemical compound characterized by its indole structure, which features a fused benzene and pyrrole ring. The presence of the 2,3-dione functional group indicates that it contains two carbonyl groups (C=O) at positions 2 and 3 of the indole ring, contributing to its reactivity and potential biological activity. The methyl group at position 7 and the nitro group at position 5 further modify its chemical properties, influencing its solubility, stability, and interaction with biological systems. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry and drug development. Its CAS number, 70343-13-4, allows for precise identification in chemical databases. As with many nitro-substituted compounds, it may also possess unique electronic properties, which can affect its reactivity and potential applications in organic synthesis or as a precursor in the development of more complex molecules. Safety and handling precautions should be observed due to the potential toxicity associated with nitro compounds.
Formula:C9H6N2O4
InChI:InChI=1S/C9H6N2O4/c1-4-2-5(11(14)15)3-6-7(4)10-9(13)8(6)12/h2-3H,1H3,(H,10,12,13)
InChI key:VREHMPHOKRQMFE-UHFFFAOYSA-N
SMILES:CC1=CC(=CC2=C1NC(=O)C2=O)[N+](=O)[O-]
Synonyms:
  • 7-Methyl-5-Nitroisatin
Found 4 products.