
CAS 70343-57-6
:7-N-(p-Hydroxyphenyl)mitomycin C
Description:
7-N-(p-Hydroxyphenyl)mitomycin C is a derivative of mitomycin C, an antibiotic and antitumor agent known for its ability to cross-link DNA, thereby inhibiting DNA synthesis and function. This compound features a p-hydroxyphenyl group attached to the nitrogen atom at the 7-position of the mitomycin C structure, which may influence its biological activity and pharmacological properties. The presence of the hydroxy group can enhance solubility and potentially alter the compound's interaction with cellular targets. Like its parent compound, 7-N-(p-Hydroxyphenyl)mitomycin C exhibits cytotoxic effects, making it of interest in cancer research. Its mechanism of action involves the formation of reactive intermediates that can bind to DNA, leading to cell cycle arrest and apoptosis in rapidly dividing cells. The compound's specific characteristics, such as stability, solubility, and efficacy, can vary based on its chemical structure and the conditions under which it is studied. Further research is necessary to fully elucidate its potential therapeutic applications and side effects.
Formula:C21H22N4O6
InChI:InChI=1S/C21H22N4O6/c1-9-15(23-10-3-5-11(26)6-4-10)18(28)14-12(8-31-20(22)29)21(30-2)19-13(24-19)7-25(21)16(14)17(9)27/h3-6,12-13,19,23-24,26H,7-8H2,1-2H3,(H2,22,29)/t12-,13+,19+,21-/m1/s1
InChI key:InChIKey=HNTGDFCASLOZEZ-YDBSYXHISA-N
SMILES:O(C)[C@]12N(C3=C([C@H]1COC(N)=O)C(=O)C(NC4=CC=C(O)C=C4)=C(C)C3=O)C[C@]5([C@@]2(N5)[H])[H]
Synonyms:- (1aS,8S,8aR,8bS)-8-[[(Aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-6-[(4-hydroxyphenyl)amino]-8a-methoxy-5-methylazirino[2′,3′:3,4]pyrrolo[1,2-a]indole-4,7-dione
- KW 2083
- Azirino[2′,3′:3,4]pyrrolo[1,2-a]indole-4,7-dione, 8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-6-[(4-hydroxyphenyl)amino]-8a-methoxy-5-methyl-, [1aS-(1aα,8β,8aα,8bα)]-
- Azirino[2′,3′:3,4]pyrrolo[1,2-a]indole-4,7-dione, 8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-6-[(4-hydroxyphenyl)amino]-8a-methoxy-5-methyl-, (1aS,8S,8aR,8bS)-
- Antibiotic M 83
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7-N-(4-Hydroxyphenyl)mitomycin C
CAS:7-N-(4-Hydroxyphenyl)mitomycin C is a bioactive chemical.Formula:C21H22N4O6Color and Shape:SolidMolecular weight:426.429
