CAS 70345-38-9
:4,6-dimethylpyrimidin-5-ol
Description:
4,6-Dimethylpyrimidin-5-ol is an organic compound belonging to the pyrimidine family, characterized by a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. This compound features two methyl groups attached to the 4 and 6 positions of the pyrimidine ring, as well as a hydroxyl group (-OH) at the 5 position, contributing to its classification as a pyrimidin-5-ol. The presence of these functional groups influences its chemical reactivity and solubility properties. Typically, compounds like 4,6-dimethylpyrimidin-5-ol exhibit moderate polarity due to the hydroxyl group, which can engage in hydrogen bonding. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Additionally, its structural features may allow it to participate in various chemical reactions, making it a valuable intermediate in synthetic organic chemistry. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C6H8N2O
InChI:InChI=1/C6H8N2O/c1-4-6(9)5(2)8-3-7-4/h3,9H,1-2H3
SMILES:Cc1c(c(C)ncn1)O
Synonyms:- 5-Hydroxy-4,6-dimethylpyrimidine
- 5-Pyrimidinol, 4,6-Dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4,6-Dimethylpyrimidin-5-ol
CAS:Formula:C6H8N2OPurity:97%Color and Shape:SolidMolecular weight:124.1434,6-Dimethylpyrimidin-5-ol
CAS:4,6-Dimethylpyrimidin-5-ol (4,6-DMP) is a small molecule that is an immunomodulatory agent. It has been shown to have immunomodulatory effects on cells in vitro and in vivo. 4,6-DMP binds to the lipid bilayer of cell membranes and inhibits the activity of phosphoinositide 3-kinase, which results in changes in the intracellular concentration of calcium ions. This leads to an increase in cytokine production by T cells and B cells, as well as an increase in IgG production by plasma cells. Kinetic constants for the reactions of 4,6-DMP with various chemical moieties have been reported. These constants are useful for determining rates of reaction with other chemicals and can be used to determine mechanisms for 4,6-DMP’s antitumor activity.Formula:C6H8N2OPurity:Min. 95%Molecular weight:124.14 g/mol


