
CAS 7035-04-3
:4-(2-Benzofuranyl)pyridine
Description:
4-(2-Benzofuranyl)pyridine, with the CAS number 7035-04-3, is an organic compound characterized by its unique structural features, which include a pyridine ring and a benzofuran moiety. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, reflecting its aromatic nature. The presence of both the pyridine and benzofuran groups contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The compound may exhibit properties such as fluorescence and can participate in various chemical reactions due to the reactivity of the nitrogen atom in the pyridine ring. Its molecular structure allows for interactions with biological targets, which can lead to diverse applications in drug development. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 4-(2-Benzofuranyl)pyridine is a compound of interest for further research in both synthetic and applied chemistry contexts.
Formula:C13H9NO
InChI:InChI=1S/C13H9NO/c1-2-4-12-11(3-1)9-13(15-12)10-5-7-14-8-6-10/h1-9H
InChI key:InChIKey=LGTULKCVKOMQDR-UHFFFAOYSA-N
SMILES:C1(=CC=2C(O1)=CC=CC2)C=3C=CN=CC3
Synonyms:- 2-(4-Pyridyl)-benzofuran
- Pyridine, 4-(2-benzofuranyl)-
- NSC 85430
- 4-(2-Benzofuranyl)pyridine
- Pyridarone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pyridarone
CAS:Pyridarone is a bioactive chemical.Formula:C13H9NOColor and Shape:SolidMolecular weight:195.22
