CAS 7035-68-9

N-Ethylbenzimidazole

Description:

N-Ethylbenzimidazole is an organic compound characterized by its structure, which consists of a benzimidazole core with an ethyl group attached to the nitrogen atom. This compound typically appears as a white to off-white solid and is known for its aromatic properties due to the presence of the benzimidazole moiety. N-Ethylbenzimidazole is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water. It exhibits basic properties due to the nitrogen atom in the benzimidazole ring, which can participate in protonation reactions. This compound is of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activities and applications in the synthesis of other chemical entities. Additionally, N-ethylbenzimidazole may serve as a building block in the development of drugs or as a ligand in coordination chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₉H₁₀N₂

InChI: InChI=1/C9H10N2/c1-2-11-7-10-8-5-3-4-6-9(8)11/h3-7H,2H2,1H3

SMILES: CCn1cnc2ccccc12

Synonyms:

• 1-Ethyl-1H-benzimidazole

1H-Benzimidazole, 1-ethyl-

CAS: 7035-68-9

Formula: C₉H₁₀N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 146.1891

Ref: IN-DA00IC1X

N-Ethylbenzimidazole

CAS: 7035-68-9

N-Ethylbenzimidazole exhibits antibacterial activity against Staphylococcus aureus, Escherichia coli, and Aspergillus niger and can be used in related research in the field of life sciences.

Formula: C₉H₁₀N₂

Purity: 99.68%

Color and Shape: Solid

Molecular weight: 146.19

Ref: TM-T206016

N-Ethylbenzimidazole

CAS: 7035-68-9

N-Ethylbenzimidazole

Purity: ≥95%

Ref: 54-OR11181

1-Ethyl-1H-benzimidazole

CAS: 7035-68-9

Formula: C₉H₁₀N₂

Purity: 97%

Molecular weight: 146.193

Ref: 10-F222303