
CAS 70364-11-3
:Silane, ethenylethoxydimethyl-, homopolymer
Description:
Silane, ethenylethoxydimethyl-, homopolymer, identified by CAS number 70364-11-3, is a polymer characterized by its silane functional groups, which enhance its adhesion properties and compatibility with various substrates. This compound is typically produced through the polymerization of silane-modified monomers, resulting in a structure that combines both organic and inorganic characteristics. The presence of ethoxy groups contributes to its hydrophilicity, making it suitable for applications in coatings, sealants, and adhesives where moisture resistance and durability are essential. Additionally, the polymer exhibits good thermal stability and chemical resistance, which are critical for its performance in demanding environments. Its versatility allows it to be utilized in various industries, including construction, automotive, and electronics, where it can improve the mechanical properties of composite materials. Overall, the unique combination of silane and ethoxy functionalities in this homopolymer makes it a valuable material in enhancing the performance of various products.
Formula:(C6H14OSi)x
InChI:InChI=1S/C6H14OSi/c1-5-7-8(3,4)6-2/h6H,2,5H2,1,3-4H3
InChI key:InChIKey=JEWCZPTVOYXPGG-UHFFFAOYSA-N
SMILES:[Si](OCC)(C=C)(C)C
Synonyms:- Silane, ethenylethoxydimethyl-, homopolymer
- Vinyldimethylethoxysilane homopolymer
- Dimethylethoxyvinylsilane homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
