CAS 70373-49-8

2-cyano-N-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetamide

Description:

2-Cyano-N-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)acetamide, with the CAS number 70373-49-8, is a chemical compound that belongs to the class of pyrazole derivatives. This substance typically exhibits a complex structure characterized by the presence of a cyano group and an acetamide functional group, which contribute to its reactivity and potential biological activity. The compound is likely to be a solid at room temperature, with solubility varying depending on the solvent used, often being more soluble in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyrazole ring, which is known for various biological activities. Additionally, the presence of the phenyl group may enhance its lipophilicity, influencing its interaction with biological targets. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₁₄H₁₄N₄O₂

InChI: InChI=1/C14H14N4O2/c1-10-13(16-12(19)8-9-15)14(20)18(17(10)2)11-6-4-3-5-7-11/h3-7H,8H2,1-2H3,(H,16,19)

SMILES: Cc1c(c(=O)n(c2ccccc2)n1C)N=C(CC#N)O

Synonyms:

• acetamide, 2-cyano-N-(2,3-dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-
• 2-Cyano-N-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)-acetamide