CAS 70373-98-7

5-amino-1-phenyl-1,2-dihydro-3H-pyrazol-3-one

Description:

5-amino-1-phenyl-1,2-dihydro-3H-pyrazol-3-one is an organic compound characterized by its pyrazolone structure, which features a five-membered ring containing two nitrogen atoms. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and ethanol. The presence of an amino group contributes to its basicity and potential reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its phenyl group enhances its hydrophobic character, influencing its solubility and interaction with other molecules. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Additionally, its unique structure allows for potential applications in materials science and as a building block in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₉H₉N₃O

InChI: InChI=1/C9H9N3O/c10-8-6-9(13)11-12(8)7-4-2-1-3-5-7/h1-6H,10H2,(H,11,13)

SMILES: c1ccc(cc1)n1c(cc(n1)O)N

5-Amino-1-phenyl-2,3-dihydro-1H-pyrazol-3-one

CAS: 70373-98-7

Versatile small molecule scaffold

Formula: C₉H₉N₃O

Purity: Min. 95%

Molecular weight: 175.19 g/mol

Ref: 3D-VCA37398