CAS 70375-43-8
:N-[(5E)-2,3-diphenyl-1,2,4-thiadiazol-5(2H)-ylidene]methanamine hydrobromide (1:1)
Description:
N-[(5E)-2,3-diphenyl-1,2,4-thiadiazol-5(2H)-ylidene]methanamine hydrobromide is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and an amine functional group. The presence of the diphenyl substituents contributes to its potential applications in organic synthesis and materials science. As a hydrobromide salt, it is typically more soluble in polar solvents, which can enhance its reactivity and utility in various chemical reactions. The compound may exhibit interesting biological activities due to the thiadiazole moiety, which is known for its diverse pharmacological properties. Its molecular structure suggests potential applications in fields such as medicinal chemistry, where derivatives of thiadiazoles are often explored for their therapeutic effects. Additionally, the compound's stability and solubility characteristics make it suitable for further research and development in both academic and industrial settings. Overall, N-[(5E)-2,3-diphenyl-1,2,4-thiadiazol-5(2H)-ylidene]methanamine hydrobromide represents a noteworthy example of a thiadiazole-based compound with potential utility in various chemical applications.
Formula:C15H14BrN3S
InChI:InChI=1/C15H13N3S.BrH/c1-16-15-17-14(12-8-4-2-5-9-12)18(19-15)13-10-6-3-7-11-13;/h2-11H,1H3;1H/b16-15+;
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
SCH-202676 HBr
CAS:SCH-202676 HBr is an allosteric agonist. It also an GPCR antagonist.Formula:C15H13N3SPurity:98%Color and Shape:SolidMolecular weight:267.35SCH-202676
CAS:SCH-202676 is a non-peptidyl allosteric modulator, which is a synthetic compound designed to influence receptor activity. It is sourced from chemical synthesis processes that allow for the precise modulation of receptor function through non-peptidyl mechanisms. The mode of action for SCH-202676 involves binding to an allosteric site on target receptors, altering their conformation and subsequently modulating their activity without directly competing with endogenous ligands.
Formula:C15H14BrN3SPurity:Min. 95%Molecular weight:348.3 g/molRef: 3D-VCA37543
Discontinued product


