CAS 70384-84-8
:Ethyl 8-chloro-2-oxo-2H-1-benzopyran-3-carboxylate
Description:
Ethyl 8-chloro-2-oxo-2H-1-benzopyran-3-carboxylate, with the CAS number 70384-84-8, is a chemical compound belonging to the class of benzopyran derivatives. This substance features a benzopyran core, which is characterized by a fused benzene and pyran ring structure, contributing to its aromatic properties. The presence of a chloro substituent at the 8-position and a carboxylate group at the 3-position enhances its reactivity and potential applications in organic synthesis. The ethyl ester functional group indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions, influencing its practical uses in various chemical processes. Overall, Ethyl 8-chloro-2-oxo-2H-1-benzopyran-3-carboxylate represents a versatile scaffold for further chemical exploration.
Formula:C12H9ClO4
InChI:InChI=1S/C12H9ClO4/c1-2-16-11(14)8-6-7-4-3-5-9(13)10(7)17-12(8)15/h3-6H,2H2,1H3
InChI key:InChIKey=CPKIKMJPFFEAIH-UHFFFAOYSA-N
SMILES:ClC1=C2C(C=C(C(OCC)=O)C(=O)O2)=CC=C1
Synonyms:- Ethyl 8-chloro-2-oxo-2H-1-benzopyran-3-carboxylate
- 2H-1-Benzopyran-3-carboxylic acid, 8-chloro-2-oxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
