CAS 70386-40-2
:(2'Z)-2,2'-[(2Z)-3-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)butane-1,2-diylidene]dihydrazinecarbothioamide
Description:
The chemical substance known as (2'Z)-2,2'-[(2Z)-3-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)butane-1,2-diylidene]dihydrazinecarbothioamide, with the CAS number 70386-40-2, is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including hydrazine, thioamide, and dioxo moieties, which contribute to its potential reactivity and biological activity. The presence of the isoindole structure suggests possible applications in medicinal chemistry, as isoindoles are often associated with various pharmacological properties. The compound's stereochemistry, indicated by the Z configuration, may influence its interactions and stability. Additionally, the presence of multiple nitrogen and sulfur atoms in its structure may impart specific properties such as solubility and reactivity in different environments. Overall, this compound's intricate structure and functional groups make it a subject of interest for further research, particularly in the fields of organic synthesis and drug development.
Formula:C14H15N7O2S2
InChI:InChI=1/C14H15N7O2S2/c1-7(10(18-20-14(16)25)6-17-19-13(15)24)21-11(22)8-4-2-3-5-9(8)12(21)23/h2-7H,1H3,(H3,15,19,24)(H3,16,20,25)/b17-6u,18-10+
Synonyms:- Hydrazinecarbothioamide, 2,2'-[1-[1-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl]-1,2-ethanediylidene]bis-
- V 6133
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phtiobuzone
CAS:<p>Phtiobuzone is a biochemical.</p>Formula:C14H15N7O2S2Color and Shape:SolidMolecular weight:377.44
