CAS 70394-23-9

3-(Dimethylamino)hexahydro-2H-azepin-2-one

Description:

3-(Dimethylamino)hexahydro-2H-azepin-2-one, with the CAS number 70394-23-9, is a cyclic amide that features a six-membered saturated ring structure containing nitrogen. This compound is characterized by the presence of a dimethylamino group, which contributes to its basicity and potential reactivity. The hexahydroazepin ring provides a stable framework, making it suitable for various chemical reactions, including nucleophilic substitutions and cyclization processes. The presence of the carbonyl group in the amide functional group enhances its ability to participate in hydrogen bonding, influencing its solubility and interaction with other molecules. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, 3-(Dimethylamino)hexahydro-2H-azepin-2-one represents a versatile structure with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₈H₁₆N₂O

InChI: InChI=1S/C8H16N2O/c1-10(2)7-5-3-4-6-9-8(7)11/h7H,3-6H2,1-2H3,(H,9,11)

InChI key: InChIKey=CFZGIDYCUWFUJR-UHFFFAOYSA-N

SMILES: N(C)(C)C1C(=O)NCCCC1

Synonyms:

• α-Dimethylaminocaprolactam
• α-Dimethylamino-ε-caprolactam
• 2H-Azepin-2-one, 3-(dimethylamino)hexahydro-
• 3-(Dimethylamino)hexahydro-2H-azepin-2-one