CymitQuimica logo

CAS 70399-10-9

:

1,5-Dihydro-1-(2,2,2-trifluoroacetyl)-2H-pyrrol-2-one

Description:
1,5-Dihydro-1-(2,2,2-trifluoroacetyl)-2H-pyrrol-2-one is a chemical compound characterized by its unique structure, which includes a pyrrolone ring and a trifluoroacetyl group. This compound typically exhibits properties associated with both heterocycles and fluorinated compounds, such as increased lipophilicity and potential biological activity. The presence of the trifluoroacetyl moiety can enhance the compound's reactivity and stability, making it of interest in various synthetic applications, particularly in medicinal chemistry. The pyrrolone structure contributes to its potential as a building block in the synthesis of more complex molecules. Additionally, the compound may display specific solubility characteristics in organic solvents, influenced by the fluorinated group. Its CAS number, 70399-10-9, allows for easy identification and retrieval of information in chemical databases. Overall, this compound's unique features make it a subject of interest for research in organic synthesis and pharmaceutical development.
Formula:C6H4F3NO2
InChI:InChI=1S/C6H4F3NO2/c7-6(8,9)5(12)10-3-1-2-4(10)11/h1-2H,3H2
InChI key:InChIKey=QKVQDTNZGFWMSG-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)N1C(=O)C=CC1
Synonyms:
  • 2H-Pyrrol-2-one, 1,5-dihydro-1-(trifluoroacetyl)-
  • 1-(Trifluoroacetyl)-2,5-dihydro-1H-pyrrol-2-one
  • 1,5-Dihydro-1-(2,2,2-trifluoroacetyl)-2H-pyrrol-2-one
  • 2H-Pyrrol-2-one, 1,5-dihydro-1-(2,2,2-trifluoroacetyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.